| Identification | |
| Name: | Benzene,1-ethynyl-2-fluoro- |
| Synonyms: | (o-Fluorophenyl)acetylene;1-Ethynyl-2-fluorobenzene; 2-Fluorophenylacetylene |
| CAS: | 766-49-4 |
| Molecular Formula: | C8H5 F |
| Molecular Weight: | 120.12 |
| InChI: | InChI=1/C8H5F/c1-2-7-5-3-4-6-8(7)9/h1,3-6H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Flash Point: | 37 oC |
| Density: | 1.06 |
| Refractive index: | 1.526 |
| Specification: |
2-Fluorophenylacetylene , its cas register number is 766-49-4. It also can be called 1-Ethynyl-2-fluorobenzene ; Benzene,1-ethynyl-2-fluoro- .It is a clear yellow to brownish liquid. |
| Flash Point: | 37 oC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
