| Identification | |
| Name: | benzoate |
| Synonyms: | Benzoate anion;Benzoic acid, ion(1-);Chebi:16150 |
| CAS: | 766-76-7 |
| Molecular Formula: | C7H5O2- |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | 249.2 deg C at 760 mm Hg |
| Solubility: | 1 G/300 ML WATER; 1 G/3 ML ETHER 1 g/23 mL oil of turpentine; 1 g/2.3 mL alcohol (cold); 1 g/30 mL carbon disulfide; 1 g/1.5 ml alcohol (boiling); 1 g/10 ml benzene; 1 g/30 ml carbon tetrachloride. Sol in volatile and fixed oils; slightly sol in petroleum ether. 0.29 g/L of benzoic acid in water at 20 deg C Acetone 55.6 g/L, benzene 12.2 g/L, carbone tetrachloride 4.1g/L, chloroform 15g/L, ethanol 58.4 g/L, ethyl ether 40.8 g/L, hexane 0.9 g/L methanol 71.5 g/L, toluene 10.6 g/L.< |
| Color: | Monoclinic tablets, plates, leaflets White scales or needle crystals |
| Safety Data | |
 |
|
