Identification |
Name: | rac Ketoprofen Acyl-b-D-glucuronide |
Synonyms: | 1-(3-Benzoly-a-methylbenzeneacetate)-b-D-glucopyranuronic Acid;dl-Ketoprofen Glucuronid;Ketoprofen Glucuronide;rac Ketoprofen Acyl-b-D-glucuronide;Ketoprofenacyl-b-D-glucuronide;1-(3-Benzoly-a-methylbenzeneacetate)--D-glucopyranuronic Acid;dl-Ketoprofen Glucuronide;rac Ketoprofen Acyl--D-glucuronide |
CAS: | 76690-94-3 |
Molecular Formula: | C22H22O9 |
Molecular Weight: | 430.407 |
InChI: | InChI=1/C22H22O9/c1-11(13-8-5-9-14(10-13)15(23)12-6-3-2-4-7-12)21(29)31-22-18(26)16(24)17(25)19(30-22)20(27)28/h2-11,16-19,22,24-26H,1H3,(H,27,28)/t11?,16-,17-,18+,19-,22-/m0/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 230.5°C |
Boiling Point: | 661°C at 760 mmHg |
Density: | 1.48g/cm3 |
Stability: | Hygroscopic, -20?C Freezer, Under Inert Atmosphere |
Refractive index: | 1.648 |
Specification: | White Solid usageEng:A metabolite of Ketoprofen (K200800). |
Flash Point: | 230.5°C |
Usage: | A metabolite of Ketoprofen |
Safety Data |
|
|