| Identification | |
| Name: | Glycine,N-[2-(mercaptomethyl)-1-oxo-3-phenylpropyl]- |
| CAS: | 76721-89-6 |
| Molecular Formula: | C12H15NO3S |
| Molecular Weight: | 253.3174 |
| InChI: | InChI=1S/C12H15NO3S/c14-11(15)7-13-12(16)10(8-17)6-9-4-2-1-3-5-9/h1-5,10,17H,6-8H2,(H,13,16)(H,14,15) |
| Molecular Structure: | ![(C12H15NO3S) Glycine,N-[2-(mercaptomethyl)-1-oxo-3-phenylpropyl]-, (?à)-;Thiorphan;](https://img1.guidechem.com/chem/e/dict/124/76721-89-6.jpg) |
| Properties | |
| Melting Point: | 138-140 °C |
| Density: | 1.246 g/cm3 |
| Refractive index: | 1.593 |
| Water Solubility: | ethanol: 50 mg/mL, clear, colorless |
| Solubility: | ethanol: 50 mg/mL, clear, colorless |
| Appearance: | off-white solid |
| Specification: | Off-White Solid usageEng:An Enkephalinase inhibitor Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Storage Temperature: | -15°C |
| Usage: | An Enkephalinase inhibitor |
| Safety Data | |
 |
|
