| Identification | |
| Name: | Spiro[furo[3,4-b]pyridine-5(7H),4'-piperidin]-7-one |
| Synonyms: | 7H-Spiro[furo[3,4-b]pyridine-5,4'-piperidin]-7-one; |
| CAS: | 767282-21-3 |
| Molecular Formula: | C11H12N2O2 |
| Molecular Weight: | 204.23 |
| InChI: | InChI=1/C11H12N2O2/c14-10-9-8(2-1-5-13-9)11(15-10)3-6-12-7-4-11/h1-2,5,12H,3-4,6-7H2 |
| Molecular Structure: | ![(C11H12N2O2) 7H-Spiro[furo[3,4-b]pyridine-5,4'-piperidin]-7-one;](https://img1.guidechem.com/chem/e/dict/212/767282-21-3.jpg) |
| Properties | |
| Density: | 1.31 |
| Refractive index: | 1.609 |
| Specification: |
The Spiro[furo[3,4-b]pyridine-5(7H),4'-piperidin]-7-one with the cas number 767282-21-3, is also called 7H-Spiro[furo[3,4-b]pyridine-5,4'-piperidin]-7-one .This product can be supplied by the following suppliers: (1)Epochem Co., Ltd.; (2)Link Chemicals Co.,Ltd.; (3)Hangzhou Sunny Chemical Co., Ltd.; (4)Nanjing Chemlin Chemical Co., Ltd.. The properties of the Spiro[furo[3,4-b]pyridine-5(7H),4'-piperidin]-7-one are: (1)#H bond acceptors: 4 ; (2)#H bond donors: 1 ; (3)#Freely Rotating Bonds: 0 ; (4)Polar Surface Area: 51.22 Å2 ; (5)Index of Refraction: 1.609 ; (6)Molar Refractivity: 53.75 cm3 ; (7)Molar Volume: 155 cm3 ; (8)Polarizability: 21.31×10-24cm3 ; (9)Surface Tension: 58.4 dyne/cm ; (10)Enthalpy of Vaporization: 69.7 kJ/mol ; (11)Vapour Pressure: 6.1×10-8 mmHg at 25°C. You can still convert the following datas into molecular structure : |
| Safety Data | |
 |
|
