| Identification | |
| Name: | 1-Bromoadamantane |
| Synonyms: | 1-Adamantyl bromide;1-Bromotricyclo(3.3.1.13,7)decane;Tricyclo[3.3.1.13, 7]decane, 1-bromo-;Adamantane, 1-bromo-;Adamantyl bromide;1-Bromo adamantane;1-Bromotricyclo[3.3.1.13,7]decane; |
| CAS: | 768-90-1 |
| EINECS: | 212-200-7 |
| Molecular Formula: | C10H15Br |
| Molecular Weight: | 215.13 |
| InChI: | InChI=1/C10H15Br/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6H2 |
| Molecular Structure: | ![(C10H15Br) 1-Adamantyl bromide;1-Bromotricyclo(3.3.1.13,7)decane;Tricyclo[3.3.1.13, 7]decane, 1-bromo-;Adamanta...](https://img.guidechem.com/casimg/768-90-1.gif) |
| Properties | |
| Density: | 1.448 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.586 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | white to almost white crystals or cryst. powder |
| Specification: |
?1-Bromoadamantane (CAS NO.768-90-1), its Synonyms are 1-Bromotricyclo(3.3.1.13,7)decane ; 3-Amino-1-adamantanol ; Tricyclo[3.3.1.13, 7]decane, 1-bromo- ; 1-Adamantyl bromide ; Adamantane, 1-bromo- ; Adamantyl bromide . |
| HS Code: | 29035990 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
