| Identification |
| Name: | Tricyclo[3.3.1.13,7]decane,1-iodo- |
| Synonyms: | Adamantane,1-iodo- (6CI,7CI,8CI);1-Adamantyl iodide;1-Iodoadamantane;Adamantyl iodide;NSC 169440; |
| CAS: | 768-93-4 |
| Molecular Formula: | C10H15I |
| Molecular Weight: | 262.1306 |
| InChI: | InChI=1/C10H15I/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6H2 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.63 g/cm3 |
| Stability: | Stable, but light and moisture sensitive. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.605 |
| Water Solubility: | reacts Stability Stable, but light and moisture sensitive. Incompatible withstrong oxidizing agents. Toxicology Not hazardous according to Directive 67/548/EEC. Toxicity data |
| Solubility: | reacts |
| Appearance: | solid |
| Safety Data |
| |
 |
