Identification |
Name: | Piperazine,1-(3,4-dichlorophenyl)-, hydrochloride (1:2) |
Synonyms: | Piperazine,1-(3,4-dichlorophenyl)-, dihydrochloride (9CI);1-(3,4-dichlorophenyl)piperazine dihydrochloride;1-(3,4-Dichlorphenyl)piperazindihydrochlorid;piperazine, 1-(3,4-dichlorophenyl)-, hydrochloride (1:2); |
CAS: | 76835-17-1 |
Molecular Formula: | C10H14Cl4N2 |
Molecular Weight: | 231.12 |
InChI: | InChI=1/C10H12Cl2N2.ClH/c11-9-2-1-8(7-10(9)12)14-5-3-13-4-6-14;/h1-2,7,13H,3-6H2;1H |
Molecular Structure: |
|
Properties |
Melting Point: | 217-220°C |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
|