| Identification | |
| Name: | 1,5-Naphthyridine,2-chloro- |
| Synonyms: | 2-Chloro-1,5-naphthyridine; |
| CAS: | 7689-62-5 |
| Molecular Formula: | C8H5ClN2 |
| Molecular Weight: | 164.59 |
| InChI: | InChI=1/C8H5ClN2/c9-8-4-3-6-7(11-8)2-1-5-10-6/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.349 |
| Refractive index: | 1.662 |
| Specification: |
The 2-Chloro-1,5-naphthyridine with its cas register number is 7689-62-5. It also can be called as 1,5-Naphthyridine,2-chloro- and the Systematic name about this chemical is 2-chloro-1,5-naphthyridine. Physical properties about 2-Chloro-1,5-naphthyridine are: (1)ACD/LogP: 1.23; (2)ACD/LogD (pH 5.5): 1.23; (3)ACD/LogD (pH 7.4): 1.23; (4)ACD/BCF (pH 5.5): 5.03; (5)ACD/BCF (pH 7.4): 5.04; (6)ACD/KOC (pH 5.5): 110.68; (7)ACD/KOC (pH 7.4): 110.7; (8)#H bond acceptors: 2; (9)Polar Surface Area: 25.78Å2; (10)Index of Refraction: 1.662; (11)Molar Refractivity: 45.17 cm3; (12)Molar Volume: 121.9 cm3; (13)Polarizability: 17.9x10-24cm3; (14)Surface Tension: 57.1 dyne/cm; (15)Enthalpy of Vaporization: 49.94 kJ/mol; (16)Vapour Pressure: 0.00605 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
