| Identification | |
| Name: | 2,4,6(1H,3H,5H)-Pyrimidinetrione,1,3-dimethyl- |
| Synonyms: | Barbituricacid, 1,3-dimethyl- (6CI,7CI,8CI);1,3-Dimethyl-1,3-diazacyclohexane-2,4,6-trione;6-Hydroxy-1,3-dimethyluracil;Dimethylbarbituric acid;N,N-Dimethylbarbituricacid;N,N'-Dimethyl-2,4,6-pyrimidinetrione;N,N'-Dimethylbarbituric acid;NSC61918; |
| CAS: | 769-42-6 |
| EINECS: | 212-211-7 |
| Molecular Formula: | C6H8N2O3 |
| Molecular Weight: | 156.14 |
| InChI: | InChI=1/C6H8N2O3/c1-7-4(9)3-5(10)8(2)6(7)11/h3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.322 g/cm3 |
| Refractive index: | 1.511 |
| Water Solubility: | 60 g/l (20ºC) in water |
| Solubility: | 60 g/l (20oC) in water |
| Appearance: | pale white crystal |
| Specification: |
?2,4,6(1H,3H,5H)-Pyrimidinetrione,1,3-dimethyl- , its cas register number is 769-42-6. It also can be called?1,3-Dimethyl-2,4,6(1H,3H,5H)-pyrimidinetrione ;?1,3-Dimethylbarbituric acid?; Barbituric acid, 1,3-dimethyl- ; and N,N'-Dimethylbarbituric acid . |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
