| Identification | |
| Name: | Benzoic acid, ethenylester |
| Synonyms: | Benzoicacid, vinyl ester (6CI,8CI); Ethenyl benzoate; NSC 2296; Vinyl benzoate |
| CAS: | 769-78-8 |
| EINECS: | 212-214-3 |
| Molecular Formula: | C9H8 O2 |
| Molecular Weight: | 148.16 |
| InChI: | InChI=1/C9H8O2/c1-2-11-9(10)8-6-4-3-5-7-8/h2-7H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 180 °F |
| Boiling Point: | 95-96 °C20 mm Hg(lit.) |
| Density: | 1.07 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.529(lit.) |
| Specification: |
Vinyl Benzoate (769-78-8) is a colorless oily liquid that evaporates easily and has a sweet smell, although high concentrations confer a less pleasant odor. It is the precursor to polystyrene and several copolymers. |
| Flash Point: | 180 °F |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
