| Identification | |
| Name: | Hexanamide,3-oxo-N-(tetrahydro-2-oxo-3-furanyl)- |
| Synonyms: | DL-3-Oxo-hexanoyl-homoserinelactone |
| CAS: | 76924-95-3 |
| Molecular Formula: | C10H15 N O4 |
| Molecular Weight: | 213.23 |
| InChI: | InChI=1/C10H15NO4/c1-4(2)6(12)10-7(15-9(10)14)5(3)8(13)11-10/h4-7,12H,1-3H3,(H,11,13)/t5-,6+,7+,10-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 220.397°C |
| Boiling Point: | 440.815°C at 760 mmHg |
| Density: | 1.28g/cm3 |
| Refractive index: | 1.524 |
| Flash Point: | 220.397°C |
| Storage Temperature: | −20°C |
| Usage: | An autoinducer of P. fischeri luciferase. A specfic genetic regulator that is unrelated to at least one of the enzyme systems that it induces, and it acts after excretion and accumulation in the extracellular medium |
| Safety Data | |
 |
|
