| Identification | |
| Name: | 2H-Indol-2-one,1,3-dihydro-6-methoxy- |
| Synonyms: | 2-Indolinone,6-methoxy- (7CI,8CI); 1,3-Dihydro-6-methoxy-2H-indol-2-one;6-Methoxy-1,3-dihydroindol-2-one; 6-Methoxy-2-indolinone; 6-Methoxy-2-oxindole;6-Methoxy-2-oxoindoline; 6-Methoxyoxindole |
| CAS: | 7699-19-6 |
| Molecular Formula: | C9H9 N O2 |
| Molecular Weight: | 163.1733 |
| InChI: | InChI=1/C9H9NO2/c1-12-7-3-2-6-4-9(11)10-8(6)5-7/h2-3,5H,4H2,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.208 g/cm3 |
| Refractive index: | 1.564 |
| Specification: |
2H-Indol-2-one,1,3-dihydro-6-methoxy- , with CAS number of 7699-19-6, can be called Aurora ka-6734 ; 6-methoxyoxindole ; 6-methoxyindol-2(3h)-one ; 6-methoxy-2-oxyindole ; 6-methoxy-2-indolinone ; 2,3-dihydro-6-methoxy-2h-indol-2-one ; 2h-indole-2-one, 1,3-dihydro-6-methoxy ; 6-methoxyindolin-2-one . |
| Safety Data | |
 |
|
