| Identification |
| Name: | Acetamide,2-[(3,3-diphenylpropyl)amino]- |
| Synonyms: | N 20C |
| CAS: | 76991-05-4 |
| Molecular Formula: | C17H20 N2 O |
| Molecular Weight: | 304.81 |
| InChI: | InChI=1/C17H20N2O.ClH/c18-17(20)13-19-12-11-16(14-7-3-1-4-8-14)15-9-5-2-6-10-15;/h1-10,16,19H,11-13H2,(H2,18,20);1H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 253°C |
| Boiling Point: | 494.7°C at 760 mmHg |
| Biological Activity: | Selective, non-competitive NMDA receptor antagonist (IC 50 = 5 μ M); binds to the receptor-associated ion channel and prevents glutamate-induced Ca 2+ influx. In vivo, displays neuroprotective activity and is reported to be brain-penetrant. |
| Flash Point: | 253°C |
| Storage Temperature: | −20°C |
| Color: | white |
| Safety Data |
| |
 |
