| Identification | |
| Name: | 2,5-Pyrrolidinedione,1,3-dimethyl-3-phenyl- |
| CAS: | 77-41-8 |
| EINECS: | 201-026-7 |
| Molecular Formula: | C12H13 N O2 |
| Molecular Weight: | 203.26 |
| InChI: | InChI=1/C13H10O6/c1-19-13(18)7-4-6-2-3-8(14)11(16)10(6)12(17)9(15)5-7/h2-5,14,16H,1H3,(H,15,17) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 191.7°C |
| Boiling Point: | 489.2°C at 760 mmHg |
| Density: | 1.59g/cm3 |
| Refractive index: | 1.692 |
| Solubility: | Freely sol in methanol, alcohol Slightly soluble in hot water; freely soluble in alcohol and ether; very soluble in chloroform. In water, 5.19X10+3 mg/L at 25 deg C (est) |
| Specification: | Light Yellow Oil usageEng:A calcium channel succinimide antiepileptic drug. Anticonvulsant. |
| Flash Point: | 191.7°C |
| Storage Temperature: | Refrigerator |
| Color: | Crystals from dilute alcohol White to grayish white, crystalline powder |
| Usage: | A calcium channel succinimide antiepileptic drug. Anticonvulsant. |
| Safety Data | |
 |
|
