| Identification | |
| Name: | 2-Butenedioic acid(2E)-, sodium salt (1:?) |
| Synonyms: | 2-Butenedioicacid (2E)-, sodium salt (9CI);2-Butenedioic acid (E)-, sodium salt;Fumaricacid, sodium salt (8CI);Sodium fumarate; |
| CAS: | 7704-73-6 |
| EINECS: | 231-725-2 |
| Molecular Formula: | C4H4O4. xNa |
| Molecular Weight: | 160.03582 |
| InChI: | InChI=1S/C4H4O4.2Na/c5-3(6)1-2-4(7)8;;/h1-2H,(H,5,6)(H,7,8);;/q;2*+1/p-2/b2-1+;; |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 290ºC |
| Density: | g/cm3 |
| Water Solubility: | Soluble in water (6.87g/100ml,25 ºC) |
| Solubility: | Soluble in water (6.87g/100ml,25 ºC) |
| Appearance: | White powder |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
