The 1H-Imidazolium, 2-(2-(4-(dimethylamino)phenyl)diazenyl)-1,3-dimethyl-, chloride (1:1) is an organic compound with the formula C13H18ClN5. The IUPAC name of this chemical is 4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline chloride. With the CAS registry number 77061-58-6, it is also named as 2-((4-(Dimethylamino)phenyl)azo)-1,3-dimethyl-1H-imidazolium chloride.
The other characteristics of this product can be summarized as: (1)#H bond acceptors: 5; (2)#H bond donors: 0; (3)#Freely Rotating Bonds: 3; (4)Rotatable Bond Count: 3; (5)Exact Mass: 279.125073; (6)MonoIsotopic Mass: 279.125073; (7)Topological Polar Surface Area: 36.8; (8)Heavy Atom Count: 19; (9)Complexity: 273; (10)Covalently-Bonded Unit Count: 2.
People can use the following data to convert to the molecule structure.
1. SMILES: [Cl-].N(=N/c1[n+](ccn1C)C)\c2ccc(N(C)C)cc2;
2. InChI: InChI=1/C13H18N5.ClH/c1-16(2)12-7-5-11(6-8-12)14-15-13-17(3)9-10-18(13)4;/h5-10H,1-4H3;1H/q+1;/p-1;
3. InChIKey: NZDXSXLYLMHYJA-REWHXWOFAW.
|