Identification |
Name: | 1,2-Benzenedicarboxylic acid, 3,4,5,6-tetrabromo-, mixed esters with diethylene glycol and propylene glycol |
Synonyms: | 1,2-Benzenedicarboxylic acid, 3,4,5,6-tetrabromo-, mixed esters with diethylene glycol and propylene glycol;3,4,5,6-tetrabromophthalic acid;3,4,5,6-Tetrabromo-1,2-benzenedicarboxylic acid, mixed esters with diethylene glycol and propylene glycol; |
CAS: | 77098-07-8 |
Molecular Formula: | C15H20Br4O9 |
Molecular Weight: | 0 |
InChI: | InChI=1S/C8H2Br4O4.C4H10O3.C3H8O2/c9-3-1(7(13)14)2(8(15)16)4(10)6(12)5(3)11;5-1-3-7-4-2-6;1-3(5)2-4/h(H,13,14)(H,15,16);5-6H,1-4H2;3-5H,2H2,1H3 |
Molecular Structure: |
 |
Properties |
Safety Data |
|
 |