| Identification | |
| Name: | 3-Indoleformic acid |
| Synonyms: | 1H-indole-3-carboxylate;Indole-3-carboxylic acid;1H-Indole-3-carboxylic acid;3-Indole carboxylic acid;3-Indolecarboxylic acid;Indole-3-carboxylicacid;formic acid/methanoic acid;3-Carboxyindole; |
| CAS: | 771-50-6 |
| EINECS: | 212-231-6 |
| Molecular Formula: | C9H7NO2 |
| Molecular Weight: | 161.15738 |
| InChI: | InChI=1S/C9H7NO2/c11-9(12)7-5-10-8-4-2-1-3-6(7)8/h1-5,10H,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.408 g/cm3 |
| Water Solubility: | SOLVENT |
| Solubility: | SOLVENT |
| Appearance: | off white crystals |
| Specification: |
? Indole-3-carboxylic acid (771-50-6) is light beige?powder, known as?1H-Indole-3-carboxylic acid ;?3-Indolecarboxylic acid ; 3-Indolylcarboxylic acid ; Acide 1H-indole-3-carboxylique ; Indole-3-carboxylicacid .?It is incompatible with?strong oxidizing agents, strong reducing agents, strong acids, strong bases, bases. When heated to decomposition, it yields?Nitrogen oxides, Carbon monoxide , Carbon dioxide . Indole-3-carboxylic acid (771-50-6) is mainly used?for the synthesis of Tropisetron . |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
