Specification: |
The (R)-1-(3,5-Difluorophenyl)ethanamine hydrochloride, with the CAS registry number 771465-40-8, is also known as Benzenemethanamine,3,5-difluoro-a-methyl-,(aR)-. The (R)-1-(3,5-Difluorophenyl)ethanamine hydrochloride belongs to the product category of Halide. This chemical's molecular formula is C8H9F2N and molecular weight is 157.1605664. What's more, its systematic name is called (1R)-1-(3,5-Difluorophenyl)ethanamine hydrochloride.
You can still convert the following datas into molecular structure:
(1) SMILES: C[C@H](c1cc(cc(c1)F)F)N.Cl
(2) InChI: InChI=1/C8H9F2N.ClH/c1-5(11)6-2-7(9)4-8(10)3-6;/h2-5H,11H2,1H3;1H/t5-;/m1./s1
(3) InChIKey: YSKNBJOMVKILCE-NUBCRITNBA
|