| Identification | |
| Name: | 3-Quinolinecarboxylicacid, 4-chloro-7-methoxy-, ethyl ester |
| Synonyms: | 4-Chloro-3-ethoxycarbonyl-7-methoxyquinoline;Ethyl 4-chloro-7-methoxy-3-quinolinecarboxylate;Ethyl7-methoxy-4-chloro-3-quinolinecarboxylate; |
| CAS: | 77156-85-5 |
| Molecular Formula: | C13H12ClNO3 |
| Molecular Weight: | 265.70 |
| InChI: | InChI=1/C13H12ClNO3/c1-3-18-13(16)10-7-15-11-6-8(17-2)4-5-9(11)12(10)14/h4-7H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.282 g/cm3 |
| Refractive index: | 1.592 |
| Specification: |
The Ethyl 4-chloro-7-methoxyquinoline-3-carboxylate with the CAS number 77156-85-5 is also called 3-Quinolinecarboxylicacid, 4-chloro-7-methoxy-, ethyl ester. Its molecular formula is C13H12ClNO3. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 3.28; (2)# of Rule of 5 Violations: 0 ; (3)#H bond acceptors: 4; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 4; (6)Polar Surface Area: 48.42 Å2; (7)Index of Refraction: 1.592; (8)Molar Refractivity: 70.16 cm3; (9)Molar Volume: 207.1 cm3; (10)Polarizability: 27.81×10-24cm3; (11)Surface Tension: 47 dyne/cm; (12)Enthalpy of Vaporization: 61.34 kJ/mol; (13)Vapour Pressure: 1.42×10-5 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
