| Identification |
| Name: | 1-Pyrrolidineacetamide,N-(2,6-dimethylphenyl)-2-oxo- |
| Synonyms: | 2-(2-Oxo-1-pyrrolidinyl)-N-(2,6-dimethylphenyl)acetamide;DM 9384;DMMPA;DMPPA;DZL 221;N-(2,6-Dimethylphenyl)-2-(2-oxo-1-pyrrolidinyl)acetamide;Translon; |
| CAS: | 77191-36-7 |
| Molecular Formula: | C14H18N2O2 |
| Molecular Weight: | 246.31 |
| InChI: | InChI=1/C14H18N2O2/c1-10-5-3-6-11(2)14(10)15-12(17)9-16-8-4-7-13(16)18/h3,5-6H,4,7-9H2,1-2H3,(H,15,17) |
| Molecular Structure: |
 |
| Properties |
| Transport: | OTH |
| Density: | 1.187 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.593 |
| Solubility: | 0.39 g/L (25 C) |
| Appearance: | white
to off-white crystalline powder |
| Biological Activity: | Cognitive enhancer that displays various pharmacological effects. Activates L/N-type calcium channels, cholinergic, monoaminergic and GABAergic systems. Displays potent neuroprotective action in the retinal ischemia-reperfusion model in vivo . |
| Storage Temperature: | Keep container tightly closed. |
| Usage: | A nootropic drug of the racetam family. |
| Safety Data |
| Hazard Symbols |
|
| |
 |
