| Identification | |
| Name: | 2-Naphthalenemethanol,6-methoxy-a-methyl- |
| CAS: | 77301-42-9 |
| Molecular Formula: | C13H14O2 |
| Molecular Weight: | 202.25 |
| InChI: | InChI=1/C13H14O2/c1-9(14)10-3-4-12-8-13(15-2)6-5-11(12)7-10/h3-9,14H,1-2H3/t9-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 111-114 °C |
| Flash Point: | 163.1°C |
| Boiling Point: | 355.6°C at 760 mmHg |
| Density: | 1.132g/cm3 |
| Refractive index: | 1.609 |
| Specification: | WHITE TO YELLOW-BEIGE CRYSTALLINE POWDER usageEng:Naproxen impurity K. Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Flash Point: | 163.1°C |
| Storage Temperature: | Refrigerator |
| Usage: | Naproxen impurity K. |
| Safety Data | |
 |
|
