Identification |
Name: | SL0101 |
CAS: | 77307-50-7 |
Molecular Formula: | C25H24O12 |
Molecular Weight: | 516.453 |
InChI: | InChI=1/C25H24O12/c1-10-21(34-11(2)26)24(35-12(3)27)20(32)25(33-10)37-23-19(31)18-16(30)8-15(29)9-17(18)36-22(23)13-4-6-14(28)7-5-13/h4-10,20-21,24-25,28-30,32H,1-3H3/t10-,20+,21?,24?,25?/m0/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 255.567°C |
Boiling Point: | 753.017°C at 760 mmHg |
Density: | 1.572g/cm3 |
Refractive index: | 1.666 |
Specification: | Tan Solid usageEng:A potent and selective inhibitor of p90 Rsk, without inhibiting the function of upstream kinases such as MEK, Raf, or PKC |
Biological Activity: | Selective inhibitor of p90 ribosomal S6 kinase (RSK) (IC 50 = 89 nM for RSK2). Does not inhibit upstream kinases such as MEK, Raf and PKC.? Inhibits the growth of MCF-7 human breast cancer cells with no effect on the normal breast cell line. |
Flash Point: | 255.567°C |
Usage: | A potent and selective inhibitor of p90 Rsk, without inhibiting the function of upstream kinases such as MEK, Raf, or PKC |
Safety Data |
|
|