| Identification | |
| Name: | Benzoic acid,2-amino-5-iodo-, methyl ester |
| Synonyms: | Anthranilicacid, 5-iodo-, methyl ester (6CI); 2-Amino-5-iodobenzoic acid methyl ester;5-Iodoanthranilic acid methyl ester; Methyl 2-amino-5-iodobenzoate; Methyl5-iodoanthranilate |
| CAS: | 77317-55-6 |
| Molecular Formula: | C8H8 I N O2 |
| Molecular Weight: | 277.06 |
| InChI: | InChI=1/C8H8INO2/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4H,10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 85 °C |
| Flash Point: | 156.9°C |
| Boiling Point: | 335.9°C at 760 mmHg |
| Density: | 1.826g/cm3 |
| Refractive index: | 1.647 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 156.9°C |
| Safety Data | |
 |
|
