| Identification | |
| Name: | N-Tri-isopropyl-B-triethyl borazole |
| Synonyms: | 2,4,6-Triethyl-1,3,5-triisopropylborazine |
| CAS: | 7739-33-5 |
| Molecular Formula: | C15H36B3N3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C15H36B3N3/c1-10-19-16(13(4)5)20(11-2)18(15(8)9)21(12-3)17(19)14(6)7/h13-15H,10-12H2,1-9H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 144.5°C |
| Boiling Point: | 315.3°C at 760 mmHg |
| Density: | 0.84g/cm3 |
| Refractive index: | 1.444 |
| Specification: |
N-Tri-isopropyl-B-triethyl borazole , its cas register number is 7739-33-5. It also can be called 2,4,6-Triethyl-1,3,5-triisopropylborazine ; BRN 2417137 ; and Borazine, 2,4,6-triethyl-1,3,5-triisopropyl- . |
| Flash Point: | 144.5°C |
| Safety Data | |
 |
|
