| Identification | |
| Name: | Benzenamine,3-chloro-4-methyl-, hydrochloride (1:1) |
| Synonyms: | Benzenamine,3-chloro-4-methyl-, hydrochloride (9CI); p-Toluidine, 3-chloro-, hydrochloride(8CI); 3-Chloro-4-methylbenzenamine hydrochloride; 3-Chloro-p-toluidinehydrochloride; 4-Methyl-3-chloroaniline hydrochloride; CPTH; CTH; DRC 1339;Starlicide |
| CAS: | 7745-89-3 |
| EINECS: | 202-446-3 |
| Molecular Formula: | C7H8 Cl N . Cl H |
| Molecular Weight: | 141.59812 |
| InChI: | InChI=1S/C7H8ClN/c1-5-2-3-6(9)4-7(5)8/h2-4H,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 26 deg C |
| Flash Point: | 100.8°C |
| Boiling Point: | 243.1°Cat760mmHg |
| Density: | 1.18g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents.Toxicology Toxic if swallowed. May be toxic if inhaled or absorbed through the skin. Risk phrases (The meani |
| Solubility: | |
| Appearance: | solid |
| Specification: | solid |
| Flash Point: | 100.8°C |
| Safety Data | |
 |
|
