| Identification |
| Name: | Benzene,2-bromo-1-methyl-4-nitro- |
| Synonyms: | Toluene,2-bromo-4-nitro- (6CI,7CI,8CI);1-Bromo-2-methyl-5-nitrobenzene;2-Bromo-1-methyl-4-nitrobenzene;3-Bromo-4-methyl-1-nitrobenzene;3-Bromo-4-methylnitrobenzene;4-Nitro-2-bromotoluene;NSC 402166;1-Bromo-2-methyl-5-nitrobenzene;2-bromo-1-methyl-4-nitrobenzene;Benzene, 2-bromo-1-methyl-4-nitro-;Toluene, 2-bromo-4-nitro-; |
| CAS: | 7745-93-9 |
| EINECS: | 231-809-9 |
| Molecular Formula: | C7H6BrNO2 |
| Molecular Weight: | 216.03 |
| InChI: | InChI=1/C7H6BrNO2/c1-5-2-3-6(9(10)11)4-7(5)8/h2-4H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.615 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.592 |
| Solubility: | Insoluble |
| Appearance: | faint yellow to yellow powder. |
| Packinggroup: | I; II; III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
