| Identification | |
| Name: | 2-Amino-5-bromopyrimidine |
| Synonyms: | 2-Pyrimidinamine, 5-bromo-;5-Bromo-2-pyrimidinamine;5-bromo-pyrimidin-2-ylamine;5-bromopyrimidin-2-amine;Pyrimidine, 2-amino-5-bromo-;ethyl 6-chloropyridazine-3-carboxylate;5-Bromopyrimidin-2-ylamine;5-Bromo-2-aminopyrimidine;2-Pyrimidinamine, 5-bromo-;5-Brom-2-pyrimidinamin;5-bromopyrimidin-2-amine; |
| CAS: | 7752-82-1 |
| Molecular Formula: | C4H4BrN3 |
| Molecular Weight: | 174 |
| InChI: | InChI=1/C4H4BrN3/c5-3-1-7-4(6)8-2-3/h1-2H,(H2,6,7,8) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 |
| Density: | 1.844g/cm3 |
| Refractive index: | 1.649 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | yellow solid |
| Specification: | Yellow Solid Safety Statements:26-60-61 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Packinggroup: | III |
| HS Code: | 29335995 |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
