| Identification | |
| Name: | 4-Isoxazolepropanoicacid, a-amino-2,3-dihydro-5-methyl-3-oxo- |
| CAS: | 77521-29-0 |
| Molecular Formula: | C7H10N2O4 |
| Molecular Weight: | 186.1653 |
| InChI: | InChI=1S/C7H10N2O4/c1-3-4(6(10)9-13-3)2-5(8)7(11)12/h5H,2,8H2,1H3,(H,9,10)(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.386 g/cm3 |
| Refractive index: | 1.541 |
| Water Solubility: | H2O: 1.2 mg/mL |
| Solubility: | H2O: 1.2 mg/mL |
| Appearance: | solid |
| Specification: | White-to-Off White Powder usageEng:A potent and selective agonist of the excitatory neurotransmitter L-glutamic Acid. AMPA does not interfere with binding sites for kainic acid in vitro, and AMPA- induced neuronal excitation is not significantly affected by NMDA antagonists |
| Biological Activity: | More water soluble hydrobromide salt of ( RS )-AMPA ((RS)-a-Amino-3-hydroxy-5-methyl-4-isoxazolepropionicacid ). |
| Storage Temperature: | 2-8°C |
| Color: | white |
| Usage: | A potent and selective agonist of the excitatory neurotransmitter L-glutamic Acid. AMPA does not interfere with binding sites for kainic acid in vitro, and AMPA- induced neuronal excitation is not significantly affected by NMDA antagonists |
| Safety Data | |
 |
|
