| Identification | |
| Name: | 2H-1-Benzopyran-2-one,6-hydroxy-7-methoxy- |
| Synonyms: | Coumarin,6-hydroxy-7-methoxy- (7CI,8CI);Herniarin, 6-hydroxy- (6CI);6-Hydroxy-7-methoxycoumarin;7-Methoxyesculetin;Esculetin, 7-methyl ether;Isoscopoletin; |
| CAS: | 776-86-3 |
| EINECS: | 212-282-4 |
| Molecular Formula: | C10H8O4 |
| Molecular Weight: | 192.16812 |
| InChI: | InChI=1S/C10H8O4/c1-13-9-5-8-6(4-7(9)11)2-3-10(12)14-8/h2-5,11H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 206-208ºC |
| Flash Point: | 172.4 ºC |
| Boiling Point: | 413.5 ºC at 760 mmHg |
| Density: | 1.377 g/cm3 |
| Refractive index: | 1.609 |
| Water Solubility: | DMSO: soluble |
| Solubility: | DMSO: soluble |
| Specification: | Safety Statements:22-24/25-36-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 172.4 ºC |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
