| Identification | |
| Name: | 2H-Imidazol-2-one,1,3-dihydro-4-methyl-5-[4-(methylthio)benzoyl]- |
| Synonyms: | Enoximone;Fenoximone; MDL 17043; Perfan; Perfane; RMI 17043 |
| CAS: | 77671-31-9 |
| Molecular Formula: | C12H12 N2 O2 S |
| Molecular Weight: | 248.30 |
| InChI: | InChI=1/C12H12N2O2S/c1-7-10(14-12(16)13-7)11(15)8-3-5-9(17-2)6-4-8/h3-6H,1-2H3,(H2,13,14,16) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3249 |
| Melting Point: | 255-258 ºC |
| Density: | 1.33 |
| Refractive index: | 1.645 |
| Solubility: | Insoluble |
| Specification: |
2H-Imidazol-2-one,1,3-dihydro-4-methyl-5-[4-(methylthio)benzoyl]- , with CAS number of 77671-31-9, can be called 1,3-Dihydro-4-methyl-5-[4-methylthiobenzoyl]-2h-imidazol-2-one ; enoximone;2h-imidazol-2-one, 1,3-dihydro-4-methyl-5-(4-(methylthio)benzoyl)- ; Fenoximone ; Pedane ; Perfan . |
| Packinggroup: | III |
| Biological Activity: | Inhibitor of type III phosphodiesterase (PDE3). Increases intracellular cyclic AMP (cAMP) concentrations and enhances myocardial contractility. Also induces concentration-dependent vasodilation in vitro . |
| Storage Temperature: | Store in a tightly sealed container. |
| Color: | light yellow |
| Usage: | Used in the treatment of congestive heart failure. . |
| Safety Data | |
 |
|
