| Identification | |
| Name: | 1,2-Dimethoxypropane |
| Synonyms: | Propylene glycol dimethyl ether; |
| CAS: | 7778-85-0 |
| EINECS: | 404-630-0 |
| Molecular Formula: | C5H12O2 |
| Molecular Weight: | 104.15 |
| InChI: | InChI=1/C5H12O2/c1-5(7-3)4-6-2/h5H,4H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3271 |
| Density: | 0.855 |
| Refractive index: | 1.3835 |
| Specification: |
1,2-Dimethoxypropane , with CAS number of 7778-85-0, can be called Propylene glycol dimethyl ether ; Propylene glycol dimethyl ether ; glyme (propylene glycol dimethyl ether) ; 1,2-Dimethoxypropane, 99+% ; Propane,1,2-dimethoxy- . |
| Packinggroup: | II |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
