| Identification | |
| Name: | 1,3,5-Triazine,1,3,5-triethylhexahydro- |
| Synonyms: | s-Triazine,1,3,5-triethylhexahydro- (6CI,7CI,8CI); 1,3,5-Triethyl-1,3,5-triazacyclohexane;1,3,5-Triethylhexahydro-1,3,5-triazine; 1,3,5-Triethylhexahydro-s-triazine;1,3,5-Tris(ethyl)hexahydro-s-triazine; Hexahydro-1,3,5-triethyl-s-triazine; NSC26771; Triethyl-trimethylenetriamine; Vancide TH |
| CAS: | 7779-27-3 |
| EINECS: | 231-924-4 |
| Molecular Formula: | C9H21 N3 |
| Molecular Weight: | 171.29 . |
| InChI: | InChI=1/C9H21N3/c1-4-10-7-11(5-2)9-12(6-3)8-10/h4-9H2,1-3H3/p+3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2927 |
| Flash Point: | 158 °F |
| Boiling Point: | 207 - 208 C |
| Density: | 0.894 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.4595(lit.) |
| Solubility: |
Appearance:clear to yellowish liquid Transport Information:180kgs Hazard Symbols:UN NO. |
| Appearance: | clear to yellowish liquid |
| Specification: |
Hexahydro-1,3,5-Triethyl-S-Triazine (7779-27-3) is a clear colourless to very slightly yellow liquid. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | I |
| Flash Point: | 158 °F |
| Safety Data | |
 |
|
