| Identification | |
| Name: | Benzeneethanol, a-(2-methylpropyl)- |
| Synonyms: | 2-Pentanol,4-methyl-1-phenyl- (4CI);Phenethyl alcohol, a-isobutyl- (8CI);4-Methyl-1-phenylpentan-2-ol;Isobutyl benzyl carbinol;a-Isobutylphenethyl alcohol; |
| CAS: | 7779-78-4 |
| EINECS: | 231-939-6 |
| Molecular Formula: | C12H18O |
| Molecular Weight: | 178.2707 |
| InChI: | InChI=1/C12H18O/c1-10(2)8-12(13)9-11-6-4-3-5-7-11/h3-7,10,12-13H,8-9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.955 g/cm3 |
| Refractive index: | 1.509 |
| Water Solubility: | colourless slightly oily liquid with a green-floral, fresh, slightly sweet odour |
| Solubility: | colourless slightly oily liquid with a green-floral, fresh, slightly sweet odour |
| Appearance: | colourless slightly oily liquid with a green-floral, fresh, slightly sweet odour |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
 |
|
