| Identification | |
| Name: | Acetamide,2-(butylamino)-N-(2-chlorophenyl)-, hydrochloride (1:1) |
| Synonyms: | Acetamide,2-(butylamino)-N-(2-chlorophenyl)-, monohydrochloride (9CI) |
| CAS: | 77791-55-0 |
| Molecular Formula: | C12H17 Cl N2 O . Cl H |
| Molecular Weight: | 277.22 |
| InChI: | InChI=1/C12H17ClN2O.ClH/c1-2-3-8-14-9-12(16)15-11-7-5-4-6-10(11)13;/h4-7,14H,2-3,8-9H2,1H3,(H,15,16);1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 190.7°C |
| Boiling Point: | 391.7°C at 760 mmHg |
| Specification: |
Synonyms of 2-(butylamino)-2'-chloro-, hydrochloride (CAS NO.77791-55-0) is a kind of poisoning goods, stimulating effect on the eyes, thermal decomposition of discharge of toxic chloride, nitrogen oxides, hydrogen chloride fumes, you need ventilation in the cold and dry environment storage; with the treasury kept separate from food materials can be deslt with water, dry powder, carbon dioxide, foam fire-extinguishing agent on the processing. |
| Flash Point: | 190.7°C |
| Safety Data | |
 |
|
