| Identification | |
| Name: | 3-Pyridinecarboxylicacid, 1,6-dihydro-6-oxo-1-phenyl- |
| Synonyms: | 6-Oxo-1-phenyl-1,6-dihydropyridine-3-carboxylicacid |
| CAS: | 77837-08-2 |
| Molecular Formula: | C12H9 N O3 |
| Molecular Weight: | 215.2 |
| InChI: | InChI=1/C12H9NO3/c14-11-7-6-9(12(15)16)8-13(11)10-4-2-1-3-5-10/h1-8H,(H,15,16) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 185.315°C |
| Boiling Point: | 382.807°C at 760 mmHg |
| Density: | 1.388g/cm3 |
| Refractive index: | 1.649 |
| Specification: | Off-White Fluffy Solid usageEng:A metabolite of Pirfenidone, a new drug to treat patients with kidney disease who have diabetes |
| Flash Point: | 185.315°C |
| Usage: | A metabolite of Pirfenidone, a new drug to treat patients with kidney disease who have diabetes |
| Safety Data | |
 |
|
