3-Morpholinecarboxylic acid (77873-76-8)

The 3-Morpholinecarboxylic acid with the cas number 77873-76-8 is also called (RS)-Morpholine-3-carboxylicacid. Both the systematic name and IUPAC name are morpholine-3-carboxylic acid. Its molecular formula is C₅H₉NO₃. This chemical belongs to the following product categories: (1)carboxylicacid; (2)pharmacetical.

The properties of the chemical are: (1)ACD/LogP: -1.37; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -3.87; (4)ACD/LogD (pH 7.4): -3.88; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 4; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 38.77Ų; (13)Index of Refraction: 1.469; (14)Molar Refractivity: 29.5 cm³; (15)Molar Volume: 105.7 cm³; (16)Polarizability: 11.69×10^-24cm³; (17)Surface Tension: 42 dyne/cm; (18)Enthalpy of Vaporization: 59.23 kJ/mol; (19)Vapour Pressure: 0.0003 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(O)C1NCCOC1
(2)InChI: InChI=1/C5H9NO3/c7-5(8)4-3-9-2-1-6-4/h4,6H,1-3H2,(H,7,8)
(3)InChIKey: JUNOWSHJELIDQP-UHFFFAOYAU