| Identification | |
| Name: | Anthracene, 9-methyl- |
| Synonyms: | 9-Methylanthracene;NSC 400540 |
| CAS: | 779-02-2 |
| EINECS: | 212-299-7 |
| Molecular Formula: | C15H12 |
| Molecular Weight: | 192.26 |
| InChI: | InChI=1/C15H12/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13/h2-10H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 9/PG 3 |
| Flash Point: | 196-197at12mmHg |
| Density: | 1.06 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.694 |
| Water Solubility: | Stability Stable. Combustible. Incompatible with strong oxidizing agents. Toxicology Harmful if swallowed. May be harmful if inhaled or absorbed through the skin.May cause serious eye damage. |
| Solubility: | Stability Stable. Combustible. Incompatible with strong oxidizing agents. Toxicology Harmful if swallowed. May be harmful if inhaled or absorbed through the skin.May cause serious eye damage. |
| Appearance: | yellow to gold crystalline solid |
| Specification: |
9-Methylanthracene , its CAS NO. is 779-02-2, the synonyms are CCRIS 2740 ; EINECS 212-299-7 ; NSC 400540 ; Anthracene, 9-methyl- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 196-197at12mmHg |
| Safety Data | |
 |
|
