| Identification | |
| Name: | Benzoic acid,4-[[(1-methylethyl)amino]carbonyl]- |
| Synonyms: | Terephthalamicacid, N-isopropyl- (7CI,8CI); N-Isopropylterephthalamic acid; Terephthalic acidisopropylamide |
| CAS: | 779-47-5 |
| Molecular Formula: | C11H13 N O3 |
| Molecular Weight: | 207.25 |
| InChI: | InChI=1/C11H13NO3/c1-7(2)12-10(13)8-3-5-9(6-4-8)11(14)15/h3-7H,1-2H3,(H,12,13)(H,14,15) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 204.1°C |
| Boiling Point: | 413.9°C at 760 mmHg |
| Density: | 1.179g/cm3 |
| Refractive index: | 1.55 |
| Specification: |
N-Isopropylterephthalamic acid , its cas register number is 779-47-5. It also can be called Benzoic acid, 4-(((1-methylethyl)amino)carbonyl)- (9CI) ; Terephthalic acid isopropylamide ; and 4-(((1-Methylethyl)amino)carbonyl)benzoic acid . |
| Flash Point: | 204.1°C |
| Safety Data | |
 |
|
