Zinc iodate (7790-37-6)

The Zinc iodate, with CAS registry number 7790-37-6, has the systematic name of zinc diiodate. And its IUPAC name is the same one. And the chemical formula of this chemical is Zn(IO₃)₂. What's more, its EINECS is 232-202-1.

Physical properties of Zinc iodate: (1)#H bond acceptors: 6; (2)#H bond donors: 2; (3)#Freely Rotating Bonds: 0; (4)Polar Surface Area: 114.4 Å².

You can still convert the following datas into molecular structure:
(1)SMILES: [Zn+2].[O-]I(=O)=O.[O-]I(=O)=O
(2)InChI: InChI=1/2HIO3.Zn/c2*2-1(3)4;/h2*(H,2,3,4);/q;;+2/p-2
(3)InChIKey: MFMKGXZULQONRI-NUQVWONBAT
(4)Std. InChI: InChI=1S/2HIO3.Zn/c2*2-1(3)4;/h2*(H,2,3,4);/q;;+2/p-2
(5)Std. InChIKey: MFMKGXZULQONRI-UHFFFAOYSA-L