| Identification | |
| Name: | Boronic acid,B-[5-fluoro-2-(phenylmethoxy)phenyl]- |
| Synonyms: | Boronicacid, [5-fluoro-2-(phenylmethoxy)phenyl]- (9CI);[2-(Benzyloxy)-5-fluorophenyl]boronic acid; |
| CAS: | 779331-47-4 |
| EINECS: | -0 |
| Molecular Formula: | C13H12BFO3 |
| Molecular Weight: | 246.04 |
| InChI: | InChI=1/C13H12BFO3/c15-11-6-7-13(12(8-11)14(16)17)18-9-10-4-2-1-3-5-10/h1-8,16-17H,9H2 |
| Molecular Structure: | ![(C13H12BFO3) Boronicacid, [5-fluoro-2-(phenylmethoxy)phenyl]- (9CI);[2-(Benzyloxy)-5-fluorophenyl]boronic acid;](https://img.guidechem.com/casimg/779331-47-4.gif) |
| Properties | |
| Melting Point: | 106-114°C |
| Density: | 1.26g/cm3 |
| Refractive index: | 1.577 |
| Specification: |
2-Benzyloxy-5-fluorophenylboronic acid with cas registry number of 779331-47-4 is also known as [2-(Benzyloxy)-5-fluorophenyl]boronic acid ; Boronic acid, B-[5-fluoro-2-(phenylmethoxy)phenyl]- ; (2-Benzyloxy-5-fluorophenyl)boronic acid ; 2-(Benzyloxy)-5-Fluorophenylboronic Acid . It would emit acrid smoke and irritating fumes when heated to decomposition. It should be stored in a cool, dry place. 2-Benzyloxy-5-fluorophenylboronic acid with cas registry number of 779331-47-4 is used as an intermediate . |
| HS Code: | 29310095 |
| Usage: | suzuki reaction |
| Safety Data | |
 |
|
