| Identification | |
| Name: | Acetamide,N-(2-chloro-6-methylphenyl)-2-(diethylamino)-N-(phenylmethyl)-, hydrochloride(1:1) |
| Synonyms: | Acetamide,N-(2-chloro-6-methylphenyl)-2-(diethylamino)-N-(phenylmethyl)-,monohydrochloride (9CI) |
| CAS: | 77966-32-6 |
| Molecular Formula: | C20H25 Cl N2 O . Cl H |
| Molecular Weight: | 381.38 |
| InChI: | InChI=1/C20H25ClN2O.ClH/c1-4-22(5-2)15-19(24)23(14-17-11-7-6-8-12-17)20-16(3)10-9-13-18(20)21;/h6-13H,4-5,14-15H2,1-3H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 244°C |
| Boiling Point: | 479.8°C at 760 mmHg |
| Specification: |
N-Benzyl-6'-chloro-2-(diethylamino)-o-acetotoluidide hydrochloride (CAS NO.77966-32-6) is also named as C 3136 ; o-Acetotoluidide, N-benzyl-6'-chloro-2-(diethylamino)-, hydrochloride . N-Benzyl-6'-chloro-2-(diethylamino)-o-acetotoluidide hydrochloride (CAS NO.77966-32-6) is highly toxic. It is flammable. It will produce toxic nitrogen oxide, chlorine and hydrogen chloride fumes when buring. So the storage environment should be ventilate, low-temperature and dry. Keep N-Benzyl-6'-chloro-2-(diethylamino)-o-acetotoluidide hydrochloride (CAS NO.77966-32-6) separate from raw materials of food. |
| Flash Point: | 244°C |
| Safety Data | |
 |
|
