| Identification | |
| Name: | 6'-Chloro-2-(ethylamino)-o-acetotoluidide, hydrochloride |
| Synonyms: | C 3063;6'-Chloro-2-(ethylamino)-o-acetotoluidide, hydrochloride;2'-Chloro-2-(ethylamino)-6'-methylacetanilide, hydrochloride;o-ACETOTOLUIDIDE, 6'-CHLORO-2-(ETHYLAMINO)-, HYDROCHLORIDE;77966-59-7;AC1L1FX3;LS-13795;[2-(2-chloro-6-methylanilino)-2-oxoethyl]-ethylazanium chloride;2-[(2-chloro-6-methylphenyl)amino]-N-ethyl-2-oxoethanaminium chloride |
| CAS: | 77966-59-7 |
| Molecular Formula: | C11H15ClN2O . ClH |
| Molecular Weight: | 263.1635 |
| InChI: | InChI=1/C11H15ClN2O.ClH/c1-3-13-7-10(15)14-11-8(2)5-4-6-9(11)12;/h4-6,13H,3,7H2,1-2H3,(H,14,15);1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 173.6°C |
| Boiling Point: | 363.4°C at 760 mmHg |
| Density: | g/cm3 |
| Specification: |
6'-Chloro-2-(ethylamino)-o-acetotoluidide, hydrochloride , its cas register number is 77966-59-7. It also can be called 2'-Chloro-2-(ethylamino)-6'-methylacetanilide, hydrochloride ; and o-Acetotoluidide, 6'-chloro-2-(ethylamino)-, hydrochloride . Its classification code is Drug / Therapeutic Agent. |
| Flash Point: | 173.6°C |
| Safety Data | |
 |
|
