| Identification | |
| Name: | Acetamide,N-butyl-N-(2,6-dimethylphenyl)-2-(ethylamino)-, hydrochloride (1:1) |
| Synonyms: | Acetamide,N-butyl-N-(2,6-dimethylphenyl)-2-(ethylamino)-, monohydrochloride (9CI) |
| CAS: | 77966-77-9 |
| Molecular Formula: | C16H26 N2 O . Cl H |
| Molecular Weight: | 298.90 |
| InChI: | InChI=1/C16H26N2O.ClH/c1-5-7-11-18(15(19)12-17-6-2)16-13(3)9-8-10-14(16)4;/h8-10,17H,5-7,11-12H2,1-4H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 188.2°C |
| Boiling Point: | 387.6°C at 760 mmHg |
| Specification: |
N-Butyl-2-(ethylamino)-2',6'-acetoxylidide hydrochloride , its cas register number is 77966-77-9. It also can be called C 3164 ; 2',6'-Acetoxylidide, N-butyl-2-(ethylamino)-, hydrochloride . When heated to decomposition it emits very toxic fumes of HCl and NOx. And N-Butyl-2-(ethylamino)-2',6'-acetoxylidide hydrochloride (CAS NO.77966-77-9) will caues an eye irritant. |
| Flash Point: | 188.2°C |
| Safety Data | |
 |
|
