| Identification | |
| Name: | 6'-Chloro-2-(propylamino)-o-butyrotoluidide hydrochloride |
| Synonyms: | C 3189;6'-Chloro-2-(propylamino)-o-butyrotoluidide hydrochloride;o-BUTYROTOLUIDIDE, 6'-CHLORO-2-(PROPYLAMINO)-, HYDROCHLORIDE;77985-17-2;AC1L1G5I;LS-48486;[1-(2-chloro-6-methylanilino)-1-oxobutan-2-yl]-propylazanium chloride;1-[(2-chloro-6-methylphenyl)amino]-1-oxo-N-propylbutan-2-aminium chloride |
| CAS: | 77985-17-2 |
| Molecular Formula: | C14H21ClN2O . ClH |
| Molecular Weight: | 305.2433 |
| InChI: | InChI=1/C14H21ClN2O.ClH/c1-4-9-16-12(5-2)14(18)17-13-10(3)7-6-8-11(13)15;/h6-8,12,16H,4-5,9H2,1-3H3,(H,17,18);1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 193.7°C |
| Boiling Point: | 396.6°C at 760 mmHg |
| Specification: |
6'-Chloro-2-(propylamino)-o-butyrotoluidide hydrochloride , its cas register number is 77985-17-2. It also can be called o-Butyrotoluidide, 6'-chloro-2-(propylamino)-, hydrochloride . Its classification code are Drug / Therapeutic Agent and Skin / Eye Irritant. |
| Flash Point: | 193.7°C |
| Safety Data | |
 |
|
