| Identification | |
| Name: | Cyclohexanol,1-[(1-hydroperoxycyclohexyl)dioxy]- |
| Synonyms: | Peroxide,1-hydroperoxycyclohexyl 1-hydroxycyclohexyl (6CI,7CI);1-Hydroxy-1'-hydroperoxydicyclohexyl peroxide; Perhexa P |
| CAS: | 78-18-2 |
| EINECS: | 201-091-1 |
| Molecular Formula: | C12H22 O5 |
| Molecular Weight: | 246.34 |
| InChI: | InChI=1/C12H22O5/c13-11(7-3-1-4-8-11)16-17-12(15-14)9-5-2-6-10-12/h13-14H,1-10H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2117/2118/2119/2896 |
| Density: | 1.2 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.518 |
| Solubility: | Insoluble in water; soluble in most organic solvents |
| Appearance: | White to colorless solid. |
| Specification: |
Cyclohexanone peroxide (78-18-2) also can be called Perhexa P ; Cyclohexanol, 1-((1-hydroperoxycyclohexyl)dioxy)- ; 1-Hydroperoxycyclohexyl 1-hydroxycyclohexyl peroxide ;and 1-Hydroxy-1'-hydroperoxydicyclohexyl peroxide . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | Grayish paste |
| Usage: | Polymer curing agent. |
| Safety Data | |
| Hazard Symbols | |
 |
|
