| Identification | |
| Name: | 2,4,8,10-Tetraoxaspiro[5.5]undecane,3,9-diethenyl- |
| Synonyms: | 2,4,8,10-Tetraoxaspiro[5.5]undecane,3,9-divinyl- (6CI,7CI,8CI); 3,9-Divinyl-2,4,8,10-tetraoxaspiro[5.5]undecane;Acrolein, cyclic diacetal with pentaerythritol; Acrolein, cyclicneopentanetetrayl acetal; Diallylidene pentaerythritol; NSC 7585;Pentaerythritol diacrolein acetal |
| CAS: | 78-19-3 |
| EINECS: | 201-092-7 |
| Molecular Formula: | C11H16 O4 |
| Molecular Weight: | 212.24 |
| InChI: | InChI=1/C11H16O4/c1-3-9-12-5-11(6-13-9)7-14-10(4-2)15-8-11/h3-4,9-10H,1-2,5-8H2 |
| Molecular Structure: | ![(C11H16O4) 2,4,8,10-Tetraoxaspiro[5.5]undecane,3,9-divinyl- (6CI,7CI,8CI); 3,9-Divinyl-2,4,8,10-tetraoxaspiro[5...](https://img.guidechem.com/casimg/78-19-3.gif) |
| Properties | |
| Density: | 1.251 |
| Refractive index: | 1.493 |
| Specification: |
3,9-Divinylspirobi(m-dioxane) (CAS NO.78-19-3) is also called 3,9-Divinyl-2,4,8,10-tetraoxaspiro(5.5)undecane ; 5-19-11-00375 (Beilstein Handbook Reference) ; AI3-24999 ; Acrolein pentaerythritol bisacetal ; Acrolein, cyclic diacetal with pentaerythritol ; Acrolein, cyclic neopentanetetrayl acetal ; Acrolein-pentaerythritol dicyclic acetal ; BRN 0149330 ; Diallylidene pentaerythritol ; NSC 7585 ; Pentaerythritol diacrolein acetal ; 2,4,8,10-Tetraoxaspiro(5,5)undecane, 3,9-diethenyl- (9CI) ; 2,4,8,10-Tetraoxaspiro(5.5)undecane, 3,9-divinyl- . 3,9-Divinylspirobi(m-dioxane) (CAS NO.78-19-3) is white crystals or crystalline mass. |
| Safety Data | |
 |
|
