| Identification | |
| Name: | 1,2-Dibromopropane |
| Synonyms: | Propylene dibromide; 1.2-Dibromoethane; 1,2-Dibromoproapne |
| CAS: | 78-75-1 |
| EINECS: | 201-139-1 |
| Molecular Formula: | C3H6Br2 |
| Molecular Weight: | 201.89 |
| InChI: | InChI=1/C3H6Br2/c1-3(5)2-4/h3H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 1.932 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents, strong bases, magnesium. |
| Refractive index: | 1.519-1.521 |
| Water Solubility: | slightly soluble |
| Solubility: | Slightly soluble (miscible with organic solvents) |
| Appearance: | clear liquid |
| Specification: |
2,3-Dibromopropane (78-75-1) is a colorless liquid slightly soluble in water (miscible with organic solvents). It is stable under ordinary conditions and mainly used as a intermediate for the synthesis of pharmaceuticals and other organic compounds. 2,3-Dibromopropane (78-75-1) is considered non-flammable. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29033036 |
| Storage Temperature: | Flammables area |
| Color: | Colorless liquid |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
