| Identification | |
| Name: | 2-Bromobutane |
| Synonyms: | sec-Butyl bromide |
| CAS: | 78-76-2 |
| EINECS: | 201-140-7 |
| Molecular Formula: | C4H9Br |
| Molecular Weight: | 137.02 |
| InChI: | InChI=1/C4H9Br/c1-3-4(2)5/h4H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2339 |
| Density: | 1.255 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.4359-1.4379 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | colourless liquid with a pleasant odour |
| Specification: | colourless liquid with a pleasant odour Safety Statements:16-23-24/25-37/39-26 16:Keep away from sources of ignition - No smoking 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Packinggroup: | II |
| HS Code: | 29033036 |
| Storage Temperature: | Flammables area |
| Color: | Clear, colorless liquid |
| Usage: | Synthesis, alkylating agent. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
